What is the structure of oleic acid?
What is the structure of oleic acid?
C18H34O2
Oleic acid/Formula
What is the main chemical structure for oleic acid?
In chemical terms, oleic acid is classified as a monounsaturated omega-9 fatty acid, abbreviated with a lipid number of 18:1 cis-9. It has the formula CH3(CH2)7CH=CH(CH2)7COOH. The name derives from the Latin word oleum, which means oil. It is the most common fatty acid in nature.
What is the condensed structure of oleic acid?
Learning Objective
| Name | Abbreviated Structural Formula | Condensed Structural Formula |
|---|---|---|
| oleic acid | C 17H 33COOH | CH 3(CH 2) 7CH=CH(CH 2) 7COOH |
| linoleic acid | C 17H 31COOH | CH 3(CH 2) 3(CH 2CH=CH) 2(CH 2) 7COOH |
| α-linolenic acid | C 17H 29COOH | CH 3(CH 2CH=CH) 3(CH 2) 7COOH |
| arachidonic acid | C 19H 31COOH | CH 3(CH 2) 4(CH 2CH=CH) 4(CH 2) 2COOH |
What is oleic acid type of bond?
As for covalent or Ionic, Oleic acid is entirely comprised of covalent bonds. However, the COOH carboxylic acid group can become deprotonated and take on the COO− form, which is anionic. But the molecule, even in its ionic form, is still entirely put together with covalent bonds.
Why is oleic acid monounsaturated?
Oleic acid is a C18:1 monounsaturated fatty acid, which exhibits one double bond after the ninth carbon from its carboxyl end (COOH) and shows 18 carbon atoms within it molecule.
What does oleic acid look like?
Oleic acid is a fatty acid that occurs naturally in various animal and vegetable fats and oils. It is an odorless, colorless oil, although commercial samples may be yellowish. In chemical terms, oleic acid is classified as a monounsaturated omega-9 fatty acid, abbreviated with a lipid number of 18:1 cis-9.
Is oleic acid saturated monounsaturated or polyunsaturated?
Since there is only one double bond, oleic acid is an example of a monounsaturated fatty acid.
What is a triglyceride structure?
Triglycerides are tri-esters consisting of a glycerol bound to three fatty acid molecules. Alcohols have a hydroxyl (HO–) group. Organic acids have a carboxyl (–COOH) group. Alcohols and organic acids join to form esters.
Is oleic acid unsaturated?
(B) This is the structure of oleic acid, an 18-carbon unsaturated fat. The carbons of the alkene functional group, the site of unsaturation, are in the rounded rectangle. Since there is only one double bond, oleic acid is an example of a monounsaturated fatty acid.
What is oleic acid monounsaturated?
What is oleic acid used for?
Oleic acid is a type of fatty acid. Oils with oleic acid are used to replace saturated fats in the diet. Oleic acid might improve heart conditions by lowering cholesterol and reducing inflammation.
What is oleic acid found in?
Oleic acid can be found naturally in numerous food sources, including edible oils, meat (such as beef, chicken, and pork), cheese, nuts, sunflower seeds, eggs, pasta, milk, olives, and avocados.
What does oleic acid do to the body?
Oleic acid is also used to induce lung damage in certain types of animals, for the purpose of testing new drugs and other means to treat lung diseases. Specifically in sheep, intravenous administration of oleic acid causes acute lung injury with corresponding pulmonary edema.
Is oleic acid organic or inorganic?
Organic oleic acid is a monounsaturated fatty acid, organic oleic acid is known as Omega-9 fatty acid. Organic oleic acid is considered one of the healthier sources of fat.
What typre of bond is oleic acid?
Oleic acid is an octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. It has a role as an EC 3.1.1.1 (carboxylesterase) inhibitor, an Escherichia coli metabolite, a plant metabolite, a Daphnia galeata metabolite, a solvent, an antioxidant and a mouse metabolite. It is a conjugate acid of an oleate.
How many double bonds in oleic acid?
Oleic acid has 18 carbon atoms and one double bond in the o-9 position (18:1 o-9), whereas eicosapentaenoic acid (EPA), with multiple double bonds, is represented as 20:5 o-3. This numerical scheme is the systematic nomenclature most commonly used.
