What is the structural formula of 3-Ethylhexane?
What is the structural formula of 3-Ethylhexane?
C8H18
3-Ethylhexane/Formula
What is the condensed formula of 3-Ethylhexane?
Identification of 3-ETHYLHEXANE Chemical Compound
| Chemical Formula | C8H18 |
|---|---|
| Molecular Weight | 114.22852 g/mol |
| IUPAC Name | 3-ethylhexane |
| SMILES String | CCCC(CC)CC |
| InChI | InChI=1S/C8H18/c1-4-7-8(5-2)6-3/h8H,4-7H2,1-3H3 |
What is the structure of 3 ethyl?
3-Ethylpentane (C7H16) is a branched saturated hydrocarbon. It is an alkane, and one of the many structural isomers of heptane, consisting of a five carbon chain with a two carbon branch at the middle carbon. An example of an alcohol derived from 3-ethylpentane is the tertiary alcohol 3-ethylpentan-3-ol.
What is the structure for 3 ethyl butane?
(2S,3S)-3-Ethylbutane-1,2,4-triol | C6H14O3 – PubChem.
What is the structure of 3 ethyl 3 Methylpentane?
3-Ethyl-3-methylpentane
| PubChem CID | 14018 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H18 |
| Synonyms | 3-Ethyl-3-methylpentane 1067-08-9 Pentane, 3-ethyl-3-methyl- 3-METHYL-3-ETHYLPENTANE 2,2-diethylbutane More… |
| Molecular Weight | 114.23 |
How many carbons are there in 3-Ethylhexane?
We know there are 6 carbons and it is alkane which ends with ena therefore, it is hexane. Next, name side branches. On the third carbon −CH2−CH3 is bonded, which is ethyl group if we go from the top left to the right. Butyl (−CH2−CH2−CH2−CH3) etc.
What is the structure of 3 methyl pentane?
C6H14
3-Methylpentane/Formula
What is the structural formula of 3 3 Dimethylpentane?
C7H16
3,3-Dimethylpentane/Formula
What is the structural formula for 2 3 3 Trimethylpentane?
2,3,3-Trimethylpentane
| PubChem CID | 11215 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H18 |
| Synonyms | 2,3,3-TRIMETHYLPENTANE 560-21-4 Pentane, 2,3,3-trimethyl- UNII-J62AAG7FN0 J62AAG7FN0 More… |
| Molecular Weight | 114.23 |
What is the correct structural formula of 3 Methyl 1 Pentyne?
C6H10
3-Methyl-1-pentyne | C6H10 – PubChem.
What is the molecular formula for 3-ethylhexane?
3-Ethylhexane. Molecular Formula C 8 H 18; Average mass 114.229 Da; Monoisotopic mass 114.140854 Da; ChemSpider ID 11599
How many rotatable bonds are in 3-ethylhexane?
The 3-ETHYLHEXANE molecule contains a total of 25 bond (s) There are 7 non-H bond (s) and 4 rotatable bond (s). The 2D chemical structure image of 3-ETHYLHEXANE is also called skeletal formula, which is the standard notation for organic molecules.
Which is a synonym for 3-ethyl 2-methylhexane?
Synonyms: 3-Ethyl-2-methylhexane. Hexane, 3-ethyl-2-methyl-. 3-ethyl-2-methyl-hexane. 16789-46-1. 2-Ethyl-3-methylhexane. More… Molecular Weight: 128.25 g/mol.
