Is 4 Methylacetophenone a ketone?
Is 4 Methylacetophenone a ketone?
4′-Methylacetophenone These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group.
What does 4 Methylacetophenone look like?
4-Methylacetophenone, belongs to the class of organic compounds known as alkyl-phenylketones. 4-methylacetophenone is a colorless clear liquid. It is a cumin-like, sweet, vanilla, cream tasting compound and it smells like hawthorn and acacia.
What is 4 Methylacetophenone used for?
4′-Methylacetophenone is used as a flavoring agent. It reacts with morpholine to get 4-(p-tolyl-thioacetyl)-morpholine in the presence of sulfur as a reagent. Further, it is used as an intermediate in the manufacture of active pharmaceutical ingredients, perfumes and cosmetics.
Is 4 ‘- Methylacetophenone polar?
4′-Methylacetophenone, also known as melilot or sweet clover, belongs to the class of organic compounds known as alkyl-phenylketones….Structure for #
| Property | Value | Source |
|---|---|---|
| Hydrogen Donor Count | 0 | ChemAxon |
| Polar Surface Area | 17.07 Ų | ChemAxon |
| Rotatable Bond Count | 1 | ChemAxon |
What is the boiling point of 4 Acetyltoluene?
438.9°F (226°C)
p-methyl acetophenone/Boiling point
What is the molecular formula of ethanone?
C2H2O
Ethenone/Formula
Is 4 Methylacetophenone a liquid?
Appearance: clear, colorless to pale yellow liquid.
What is the structure of 4 Fluoroacetophenone?
Identification of 4-FLUOROACETOPHENONE Chemical Compound
| Chemical Formula | C8H7FO |
|---|---|
| IUPAC Name | 1-(4-fluorophenyl)ethan-1-one |
| SMILES String | CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H7FO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3 |
| InChIKey | ZDPAWHACYDRYIW-UHFFFAOYSA-N |
What is the boiling point of benzophenone?
581.7°F (305.4°C)
Benzophenone/Boiling point
Why ethanone is not possible?
Because functional group ketone occurs only on inner carbons and not on terminal ones. To obtain a ketone we need minimum 3 carbons so the one in between has the ketone group -C=O- that’s why methanone and ethanone do not occur.
What is the common name of ethanone?
| PubChem CID | 109194 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C16H26O |
| Synonyms | UNII-Z578SE5DGN 68155-67-9 1-(2,3,8,8-tetramethyl-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl)ethanone Ethanone, 1-(1,2,3,4,6,7,8,8a-octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)- Z578SE5DGN More… |
What is the molecular formula for 4’methylacetophenone?
4′-Methylacetophenone CAS Number: 122-00-9: Molecular Weight: 134.175: Density: 1.0±0.1 g/cm3: Boiling Point: 211.0±9.0 °C at 760 mmHg: Molecular Formula: C 9 H 10 O: Melting Point: 45-49 °C(lit.) MSDS: Chinese USA: Flash Point: 92.2±0.0 °C: Symbol: GHS07: Signal Word: Warning
What can 4 ′ methylacetophenone be used for?
45-49 °C (lit.) 45-49 °C (lit.) 4′-methylacetophenone can be used as a fragrance material. 4′-Methylacetophenone is wildly occurs in volatile compounds in food and in some natural complex substances (NCS) [1].
How is stereoselective reductive metabolism of acetophenone studied?
Chem. 16 , 1084-9, (2008) Stereoselective reductive metabolism of various p-substituted acetophenone derivatives was studied using isolated rat liver 3alpha-hydroxysteroid dehydrogenase (3alpha-HSD). Kinetic experiments were p…
